About 2-prop-2-enoyloxyethyl 2-(3-butyl-6-chloro-1,3-benzothiazol-2-ylidene)-2-cyanoacetate
2-prop-2-enoyloxyethyl 2-(3-butyl-6-chloro-1,3-benzothiazol-2-ylidene)-2-cyanoacetate (PubChem CID 76619833) has the molecular formula C19H19ClN2O4S
and a molecular weight of 406.89 g/mol. Its IUPAC name is 2-prop-2-enoyloxyethyl 2-(3-butyl-6-chloro-1,3-benzothiazol-2-ylidene)-2-cyanoacetate.
Molecular Properties
| Compound Name | 2-prop-2-enoyloxyethyl 2-(3-butyl-6-chloro-1,3-benzothiazol-2-ylidene)-2-cyanoacetate |
| PubChem CID | 76619833 |
| Molecular Formula | C19H19ClN2O4S |
| Molecular Weight | 406.89 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | 2-prop-2-enoyloxyethyl 2-(3-butyl-6-chloro-1,3-benzothiazol-2-ylidene)-2-cyanoacetate |
| SMILES | C=CC(=O)OCCOC(=O)C(C#N)=C1Sc2cc(Cl)ccc2N1CCCC |
| InChI | InChI=1S/C19H19ClN2O4S/c1-3-5-8-22-15-7-6-13(20)11-16(15)27-18(22)14(12-21)19(24)26-10-9-25-17(23)4-2/h4,6-7,11H,2-3,5,8-10H2,1H3 |
| InChIKey | LQKOUZVDZIGRPW-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.89 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-prop-2-enoyloxyethyl 2-(3-butyl-6-chloro-1,3-benzothiazol-2-ylidene)-2-cyanoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-prop-2-enoyloxyethyl 2-(3-butyl-6-chloro-1,3-benzothiazol-2-ylidene)-2-cyanoacetate?
The IUPAC name of 2-prop-2-enoyloxyethyl 2-(3-butyl-6-chloro-1,3-benzothiazol-2-ylidene)-2-cyanoacetate (CID 76619833) is 2-prop-2-enoyloxyethyl 2-(3-butyl-6-chloro-1,3-benzothiazol-2-ylidene)-2-cyanoacetate.
What is the SMILES notation for 2-prop-2-enoyloxyethyl 2-(3-butyl-6-chloro-1,3-benzothiazol-2-ylidene)-2-cyanoacetate?
The canonical SMILES for 2-prop-2-enoyloxyethyl 2-(3-butyl-6-chloro-1,3-benzothiazol-2-ylidene)-2-cyanoacetate is C=CC(=O)OCCOC(=O)C(C#N)=C1Sc2cc(Cl)ccc2N1CCCC.
What is the InChIKey of 2-prop-2-enoyloxyethyl 2-(3-butyl-6-chloro-1,3-benzothiazol-2-ylidene)-2-cyanoacetate?
The InChIKey is LQKOUZVDZIGRPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19ClN2O4S/c1-3-5-8-22-15-7-6-13(20)11-16(15)27-18(22)14(12-21)19(24)26-10-9-25-17(23)4-2/h4,6-7,11H,2-3,5,8-10H2,1H3.
What are the key properties of 2-prop-2-enoyloxyethyl 2-(3-butyl-6-chloro-1,3-benzothiazol-2-ylidene)-2-cyanoacetate?
2-prop-2-enoyloxyethyl 2-(3-butyl-6-chloro-1,3-benzothiazol-2-ylidene)-2-cyanoacetate has a molecular weight of 406.89 g/mol, XLogP of 4.06, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-prop-2-enoyloxyethyl 2-(3-butyl-6-chloro-1,3-benzothiazol-2-ylidene)-2-cyanoacetate is sourced from PubChem (CID 76619833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).