C23H26N4O6S — CID 76621955
prop-2-enyl 2-cyano-2-[3-ethyl-5-[[3-[[2-(2-methoxyethoxy)acetyl]amino]anilino]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]acetate (PubChem CID 76621955) has the molecular formula C23H26N4O6S and a molecular weight of 486.55 g/mol. Its IUPAC name is prop-2-enyl 2-cyano-2-[3-ethyl-5-[[3-[[2-(2-methoxyethoxy)acetyl]amino]anilino]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]acetate.
| Compound Name | prop-2-enyl 2-cyano-2-[3-ethyl-5-[[3-[[2-(2-methoxyethoxy)acetyl]amino]anilino]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]acetate |
|---|---|
| PubChem CID | 76621955 |
| Molecular Formula | C23H26N4O6S |
| Molecular Weight | 486.55 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | prop-2-enyl 2-cyano-2-[3-ethyl-5-[[3-[[2-(2-methoxyethoxy)acetyl]amino]anilino]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]acetate |
| SMILES | C=CCOC(=O)C(C#N)=c1sc(=CNc2cccc(NC(=O)COCCOC)c2)c(=O)n1CC |
| InChI | InChI=1S/C23H26N4O6S/c1-4-9-33-23(30)18(13-24)22-27(5-2)21(29)19(34-22)14-25-16-7-6-8-17(12-16)26-20(28)15-32-11-10-31-3/h4,6-8,12,14,25H,1,5,9-11,15H2,2-3H3,(H,26,28) |
| InChIKey | QLNGOXVHCBNYED-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 131.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.55 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|