C24H27N5O4S2 — CID 76631224
2-cyclopentyloxyimino-2-(4-methylsulfonylphenyl)-N-[5-[(pyridin-2-ylmethylamino)methyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 76631224) has the molecular formula C24H27N5O4S2 and a molecular weight of 513.65 g/mol. Its IUPAC name is 2-cyclopentyloxyimino-2-(4-methylsulfonylphenyl)-N-[5-[(pyridin-2-ylmethylamino)methyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-cyclopentyloxyimino-2-(4-methylsulfonylphenyl)-N-[5-[(pyridin-2-ylmethylamino)methyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 76631224 |
| Molecular Formula | C24H27N5O4S2 |
| Molecular Weight | 513.65 g/mol |
| Exact Mass | 513.15 |
| IUPAC Name | 2-cyclopentyloxyimino-2-(4-methylsulfonylphenyl)-N-[5-[(pyridin-2-ylmethylamino)methyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | CS(=O)(=O)c1ccc(C(=NOC2CCCC2)C(=O)Nc2ncc(CNCc3ccccn3)s2)cc1 |
| InChI | InChI=1S/C24H27N5O4S2/c1-35(31,32)21-11-9-17(10-12-21)22(29-33-19-7-2-3-8-19)23(30)28-24-27-16-20(34-24)15-25-14-18-6-4-5-13-26-18/h4-6,9-13,16,19,25H,2-3,7-8,14-15H2,1H3,(H,27,28,30) |
| InChIKey | SPDDSJSXEHIGID-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 122.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.65 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|