C14H23N3O6 — CID 7663252
methyl (2R)-2-[[(2R)-4-acetyl-1-(2-methoxyacetyl)piperazine-2-carbonyl]amino]propanoate (PubChem CID 7663252) has the molecular formula C14H23N3O6 and a molecular weight of 329.35 g/mol. Its IUPAC name is methyl (2R)-2-[[(2R)-4-acetyl-1-(2-methoxyacetyl)piperazine-2-carbonyl]amino]propanoate.
| Compound Name | methyl (2R)-2-[[(2R)-4-acetyl-1-(2-methoxyacetyl)piperazine-2-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 7663252 |
| Molecular Formula | C14H23N3O6 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | methyl (2R)-2-[[(2R)-4-acetyl-1-(2-methoxyacetyl)piperazine-2-carbonyl]amino]propanoate |
| SMILES | COCC(=O)N1CCN(C(C)=O)C[C@@H]1C(=O)N[C@H](C)C(=O)OC |
| InChI | InChI=1S/C14H23N3O6/c1-9(14(21)23-4)15-13(20)11-7-16(10(2)18)5-6-17(11)12(19)8-22-3/h9,11H,5-8H2,1-4H3,(H,15,20)/t9-,11-/m1/s1 |
| InChIKey | AEQVTILETLWIOU-MWLCHTKSSA-N |
| XLogP | -1.63 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |