About (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 2-methylfuran-3-carboxylate
(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 2-methylfuran-3-carboxylate (PubChem CID 7663507) has the molecular formula C13H10N2O4S
and a molecular weight of 290.30 g/mol. Its IUPAC name is (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 2-methylfuran-3-carboxylate.
Molecular Properties
| Compound Name | (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 2-methylfuran-3-carboxylate |
| PubChem CID | 7663507 |
| Molecular Formula | C13H10N2O4S |
| Molecular Weight | 290.30 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 2-methylfuran-3-carboxylate |
| SMILES | Cc1occc1C(=O)OCc1cc(=O)n2ccsc2n1 |
| InChI | InChI=1S/C13H10N2O4S/c1-8-10(2-4-18-8)12(17)19-7-9-6-11(16)15-3-5-20-13(15)14-9/h2-6H,7H2,1H3 |
| InChIKey | ZLWYIXUKVYOYLL-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 73.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.30 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 2-methylfuran-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 2-methylfuran-3-carboxylate?
The IUPAC name of (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 2-methylfuran-3-carboxylate (CID 7663507) is (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 2-methylfuran-3-carboxylate.
What is the SMILES notation for (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 2-methylfuran-3-carboxylate?
The canonical SMILES for (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 2-methylfuran-3-carboxylate is Cc1occc1C(=O)OCc1cc(=O)n2ccsc2n1.
What is the InChIKey of (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 2-methylfuran-3-carboxylate?
The InChIKey is ZLWYIXUKVYOYLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2O4S/c1-8-10(2-4-18-8)12(17)19-7-9-6-11(16)15-3-5-20-13(15)14-9/h2-6H,7H2,1H3.
What are the key properties of (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 2-methylfuran-3-carboxylate?
(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 2-methylfuran-3-carboxylate has a molecular weight of 290.30 g/mol, XLogP of 2.01, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 2-methylfuran-3-carboxylate is sourced from PubChem (CID 7663507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).