C24H29N3O — CID 76636223
5-tert-butyl-4-[[4-(diethylamino)phenyl]methylidene]-2-phenylpyrazol-3-one (PubChem CID 76636223) has the molecular formula C24H29N3O and a molecular weight of 375.52 g/mol. Its IUPAC name is 5-tert-butyl-4-[[4-(diethylamino)phenyl]methylidene]-2-phenylpyrazol-3-one.
| Compound Name | 5-tert-butyl-4-[[4-(diethylamino)phenyl]methylidene]-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 76636223 |
| Molecular Formula | C24H29N3O |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | 5-tert-butyl-4-[[4-(diethylamino)phenyl]methylidene]-2-phenylpyrazol-3-one |
| SMILES | CCN(CC)c1ccc(C=C2C(=O)N(c3ccccc3)N=C2C(C)(C)C)cc1 |
| InChI | InChI=1S/C24H29N3O/c1-6-26(7-2)19-15-13-18(14-16-19)17-21-22(24(3,4)5)25-27(23(21)28)20-11-9-8-10-12-20/h8-17H,6-7H2,1-5H3 |
| InChIKey | FBXWQEVELJWZHN-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|