C31H36N4O13 — CID 76639752
1-(5,6-dinitrooxyhexoxycarbonyloxy)ethyl 2-(4,6-dimethylpyrimidin-2-yl)oxy-3-methoxy-3,3-diphenylpropanoate (PubChem CID 76639752) has the molecular formula C31H36N4O13 and a molecular weight of 672.64 g/mol. Its IUPAC name is 1-(5,6-dinitrooxyhexoxycarbonyloxy)ethyl 2-(4,6-dimethylpyrimidin-2-yl)oxy-3-methoxy-3,3-diphenylpropanoate.
| Compound Name | 1-(5,6-dinitrooxyhexoxycarbonyloxy)ethyl 2-(4,6-dimethylpyrimidin-2-yl)oxy-3-methoxy-3,3-diphenylpropanoate |
|---|---|
| PubChem CID | 76639752 |
| Molecular Formula | C31H36N4O13 |
| Molecular Weight | 672.64 g/mol |
| Exact Mass | 672.23 |
| IUPAC Name | 1-(5,6-dinitrooxyhexoxycarbonyloxy)ethyl 2-(4,6-dimethylpyrimidin-2-yl)oxy-3-methoxy-3,3-diphenylpropanoate |
| SMILES | COC(c1ccccc1)(c1ccccc1)C(Oc1nc(C)cc(C)n1)C(=O)OC(C)OC(=O)OCCCCC(CO[N+](=O)[O-])O[N+](=O)[O-] |
| InChI | InChI=1S/C31H36N4O13/c1-21-19-22(2)33-29(32-21)47-27(31(42-4,24-13-7-5-8-14-24)25-15-9-6-10-16-25)28(36)45-23(3)46-30(37)43-18-12-11-17-26(48-35(40)41)20-44-34(38)39/h5-10,13-16,19,23,26-27H,11-12,17-18,20H2,1-4H3 |
| InChIKey | SHRZXNFFPOLKDA-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 210.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.64 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|