C28H34N4O6 — CID 76639767
6-[[2-(4,6-dimethylpyrimidin-2-yl)oxy-3-methoxy-3,3-diphenylpropanoyl]amino]hexyl nitrate (PubChem CID 76639767) has the molecular formula C28H34N4O6 and a molecular weight of 522.60 g/mol. Its IUPAC name is 6-[[2-(4,6-dimethylpyrimidin-2-yl)oxy-3-methoxy-3,3-diphenylpropanoyl]amino]hexyl nitrate.
| Compound Name | 6-[[2-(4,6-dimethylpyrimidin-2-yl)oxy-3-methoxy-3,3-diphenylpropanoyl]amino]hexyl nitrate |
|---|---|
| PubChem CID | 76639767 |
| Molecular Formula | C28H34N4O6 |
| Molecular Weight | 522.60 g/mol |
| Exact Mass | 522.25 |
| IUPAC Name | 6-[[2-(4,6-dimethylpyrimidin-2-yl)oxy-3-methoxy-3,3-diphenylpropanoyl]amino]hexyl nitrate |
| SMILES | COC(c1ccccc1)(c1ccccc1)C(Oc1nc(C)cc(C)n1)C(=O)NCCCCCCO[N+](=O)[O-] |
| InChI | InChI=1S/C28H34N4O6/c1-21-20-22(2)31-27(30-21)38-25(26(33)29-18-12-4-5-13-19-37-32(34)35)28(36-3,23-14-8-6-9-15-23)24-16-10-7-11-17-24/h6-11,14-17,20,25H,4-5,12-13,18-19H2,1-3H3,(H,29,33) |
| InChIKey | RTLJAMHISZPERR-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 125.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.60 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|