C24H23N5O2 — CID 76643004
N-[1-(4-methoxyphenyl)ethyl]-3-(4-methylphenyl)-5-(tetrazol-1-yl)benzamide (PubChem CID 76643004) has the molecular formula C24H23N5O2 and a molecular weight of 413.48 g/mol. Its IUPAC name is N-[1-(4-methoxyphenyl)ethyl]-3-(4-methylphenyl)-5-(tetrazol-1-yl)benzamide.
| Compound Name | N-[1-(4-methoxyphenyl)ethyl]-3-(4-methylphenyl)-5-(tetrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 76643004 |
| Molecular Formula | C24H23N5O2 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | N-[1-(4-methoxyphenyl)ethyl]-3-(4-methylphenyl)-5-(tetrazol-1-yl)benzamide |
| SMILES | COc1ccc(C(C)NC(=O)c2cc(-c3ccc(C)cc3)cc(-n3cnnn3)c2)cc1 |
| InChI | InChI=1S/C24H23N5O2/c1-16-4-6-19(7-5-16)20-12-21(14-22(13-20)29-15-25-27-28-29)24(30)26-17(2)18-8-10-23(31-3)11-9-18/h4-15,17H,1-3H3,(H,26,30) |
| InChIKey | ZEPNMIMLJOKDMZ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |