C19H17F5N6O2 — CID 76643069
N-(1-hydroxypropan-2-yl)-3-(5-methyl-2-pyridinyl)-5-[5-(1,1,2,2,2-pentafluoroethyl)tetrazol-1-yl]benzamide (PubChem CID 76643069) has the molecular formula C19H17F5N6O2 and a molecular weight of 456.38 g/mol. Its IUPAC name is N-(1-hydroxypropan-2-yl)-3-(5-methyl-2-pyridinyl)-5-[5-(1,1,2,2,2-pentafluoroethyl)tetrazol-1-yl]benzamide.
| Compound Name | N-(1-hydroxypropan-2-yl)-3-(5-methyl-2-pyridinyl)-5-[5-(1,1,2,2,2-pentafluoroethyl)tetrazol-1-yl]benzamide |
|---|---|
| PubChem CID | 76643069 |
| Molecular Formula | C19H17F5N6O2 |
| Molecular Weight | 456.38 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | N-(1-hydroxypropan-2-yl)-3-(5-methyl-2-pyridinyl)-5-[5-(1,1,2,2,2-pentafluoroethyl)tetrazol-1-yl]benzamide |
| SMILES | Cc1ccc(-c2cc(C(=O)NC(C)CO)cc(-n3nnnc3C(F)(F)C(F)(F)F)c2)nc1 |
| InChI | InChI=1S/C19H17F5N6O2/c1-10-3-4-15(25-8-10)12-5-13(16(32)26-11(2)9-31)7-14(6-12)30-17(27-28-29-30)18(20,21)19(22,23)24/h3-8,11,31H,9H2,1-2H3,(H,26,32) |
| InChIKey | FJKRKFVPIBMIGO-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.38 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|