C16H16FN3O4 — CID 7664397
ethyl 2-[[2-[3-(4-fluorophenyl)-6-oxopyridazin-1-yl]acetyl]amino]acetate (PubChem CID 7664397) has the molecular formula C16H16FN3O4 and a molecular weight of 333.32 g/mol. Its IUPAC name is ethyl 2-[[2-[3-(4-fluorophenyl)-6-oxopyridazin-1-yl]acetyl]amino]acetate.
| Compound Name | ethyl 2-[[2-[3-(4-fluorophenyl)-6-oxopyridazin-1-yl]acetyl]amino]acetate |
|---|---|
| PubChem CID | 7664397 |
| Molecular Formula | C16H16FN3O4 |
| Molecular Weight | 333.32 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | ethyl 2-[[2-[3-(4-fluorophenyl)-6-oxopyridazin-1-yl]acetyl]amino]acetate |
| SMILES | CCOC(=O)CNC(=O)Cn1nc(-c2ccc(F)cc2)ccc1=O |
| InChI | InChI=1S/C16H16FN3O4/c1-2-24-16(23)9-18-14(21)10-20-15(22)8-7-13(19-20)11-3-5-12(17)6-4-11/h3-8H,2,9-10H2,1H3,(H,18,21) |
| InChIKey | UOQIMWNTNBMNHP-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.32 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |