C7H12NO- — CID 76646709
5-methanidyl-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole (PubChem CID 76646709) has the molecular formula C7H12NO- and a molecular weight of 126.18 g/mol. Its IUPAC name is 5-methanidyl-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole.
| Compound Name | 5-methanidyl-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole |
|---|---|
| PubChem CID | 76646709 |
| Molecular Formula | C7H12NO- |
| Molecular Weight | 126.18 g/mol |
| Exact Mass | 126.09 |
| IUPAC Name | 5-methanidyl-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole |
| SMILES | [CH2-]N1CC2COCC2C1 |
| InChI | InChI=1S/C7H12NO/c1-8-2-6-4-9-5-7(6)3-8/h6-7H,1-5H2/q-1 |
| InChIKey | PXTSMHGWTHBUOK-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.18 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|