C26H25FN4O4 — CID 76646914
3-fluoro-10-(3-hydroxyphenyl)-4-methoxy-15-methyl-13-[2-(prop-2-ynylamino)ethyl]-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraene-12,14-dione (PubChem CID 76646914) has the molecular formula C26H25FN4O4 and a molecular weight of 476.51 g/mol. Its IUPAC name is 3-fluoro-10-(3-hydroxyphenyl)-4-methoxy-15-methyl-13-[2-(prop-2-ynylamino)ethyl]-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraene-12,14-dione.
| Compound Name | 3-fluoro-10-(3-hydroxyphenyl)-4-methoxy-15-methyl-13-[2-(prop-2-ynylamino)ethyl]-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraene-12,14-dione |
|---|---|
| PubChem CID | 76646914 |
| Molecular Formula | C26H25FN4O4 |
| Molecular Weight | 476.51 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | 3-fluoro-10-(3-hydroxyphenyl)-4-methoxy-15-methyl-13-[2-(prop-2-ynylamino)ethyl]-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraene-12,14-dione |
| SMILES | C#CCNCCN1C(=O)N2C(c3cccc(O)c3)c3[nH]c4ccc(OC)c(F)c4c3CC2(C)C1=O |
| InChI | InChI=1S/C26H25FN4O4/c1-4-10-28-11-12-30-24(33)26(2)14-17-20-18(8-9-19(35-3)21(20)27)29-22(17)23(31(26)25(30)34)15-6-5-7-16(32)13-15/h1,5-9,13,23,28-29,32H,10-12,14H2,2-3H3 |
| InChIKey | PBWWCVQZDZGLRF-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 97.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.51 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|