C17H18N2O5 — CID 7664984
ethyl 4-[3-(3-methoxyphenyl)-6-oxopyridazin-1-yl]-3-oxobutanoate (PubChem CID 7664984) has the molecular formula C17H18N2O5 and a molecular weight of 330.34 g/mol. Its IUPAC name is ethyl 4-[3-(3-methoxyphenyl)-6-oxopyridazin-1-yl]-3-oxobutanoate.
| Compound Name | ethyl 4-[3-(3-methoxyphenyl)-6-oxopyridazin-1-yl]-3-oxobutanoate |
|---|---|
| PubChem CID | 7664984 |
| Molecular Formula | C17H18N2O5 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | ethyl 4-[3-(3-methoxyphenyl)-6-oxopyridazin-1-yl]-3-oxobutanoate |
| SMILES | CCOC(=O)CC(=O)Cn1nc(-c2cccc(OC)c2)ccc1=O |
| InChI | InChI=1S/C17H18N2O5/c1-3-24-17(22)10-13(20)11-19-16(21)8-7-15(18-19)12-5-4-6-14(9-12)23-2/h4-9H,3,10-11H2,1-2H3 |
| InChIKey | OOKIIYUCZYYDQT-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 87.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|