About ethyl N-pyridin-4-ylcarbamate
ethyl N-pyridin-4-ylcarbamate (PubChem CID 766500) has the molecular formula C8H10N2O2
and a molecular weight of 166.18 g/mol. Its IUPAC name is ethyl N-pyridin-4-ylcarbamate.
Molecular Properties
| Compound Name | ethyl N-pyridin-4-ylcarbamate |
| PubChem CID | 766500 |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | ethyl N-pyridin-4-ylcarbamate |
| SMILES | CCOC(=O)Nc1ccncc1 |
| InChI | InChI=1S/C8H10N2O2/c1-2-12-8(11)10-7-3-5-9-6-4-7/h3-6H,2H2,1H3,(H,9,10,11) |
| InChIKey | RPJQHJLOMYJUHA-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl N-pyridin-4-ylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-pyridin-4-ylcarbamate?
The IUPAC name of ethyl N-pyridin-4-ylcarbamate (CID 766500) is ethyl N-pyridin-4-ylcarbamate.
What is the SMILES notation for ethyl N-pyridin-4-ylcarbamate?
The canonical SMILES for ethyl N-pyridin-4-ylcarbamate is CCOC(=O)Nc1ccncc1.
What is the InChIKey of ethyl N-pyridin-4-ylcarbamate?
The InChIKey is RPJQHJLOMYJUHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O2/c1-2-12-8(11)10-7-3-5-9-6-4-7/h3-6H,2H2,1H3,(H,9,10,11).
What are the key properties of ethyl N-pyridin-4-ylcarbamate?
ethyl N-pyridin-4-ylcarbamate has a molecular weight of 166.18 g/mol, XLogP of 1.65, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-pyridin-4-ylcarbamate is sourced from PubChem (CID 766500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).