C12H14O2 — CID 766502
3,4,6,7,8,9-hexahydro-2H-dibenzofuran-1-one (PubChem CID 766502) has the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. Its IUPAC name is 3,4,6,7,8,9-hexahydro-2H-dibenzofuran-1-one.
| Compound Name | 3,4,6,7,8,9-hexahydro-2H-dibenzofuran-1-one |
|---|---|
| PubChem CID | 766502 |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | 3,4,6,7,8,9-hexahydro-2H-dibenzofuran-1-one |
| SMILES | O=C1CCCc2oc3c(c21)CCCC3 |
| InChI | InChI=1S/C12H14O2/c13-9-5-3-7-11-12(9)8-4-1-2-6-10(8)14-11/h1-7H2 |
| InChIKey | OYDGPUASTGBUQY-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |