C25H26BrF2NO5 — CID 76650562
methyl 4-[3-[4-[4-(3-bromophenyl)-4,4-difluoro-3-hydroxybut-1-enyl]-2-oxo-1,3-oxazinan-3-yl]propyl]benzoate (PubChem CID 76650562) has the molecular formula C25H26BrF2NO5 and a molecular weight of 538.39 g/mol. Its IUPAC name is methyl 4-[3-[4-[4-(3-bromophenyl)-4,4-difluoro-3-hydroxybut-1-enyl]-2-oxo-1,3-oxazinan-3-yl]propyl]benzoate.
| Compound Name | methyl 4-[3-[4-[4-(3-bromophenyl)-4,4-difluoro-3-hydroxybut-1-enyl]-2-oxo-1,3-oxazinan-3-yl]propyl]benzoate |
|---|---|
| PubChem CID | 76650562 |
| Molecular Formula | C25H26BrF2NO5 |
| Molecular Weight | 538.39 g/mol |
| Exact Mass | 537.10 |
| IUPAC Name | methyl 4-[3-[4-[4-(3-bromophenyl)-4,4-difluoro-3-hydroxybut-1-enyl]-2-oxo-1,3-oxazinan-3-yl]propyl]benzoate |
| SMILES | COC(=O)c1ccc(CCCN2C(=O)OCCC2C=CC(O)C(F)(F)c2cccc(Br)c2)cc1 |
| InChI | InChI=1S/C25H26BrF2NO5/c1-33-23(31)18-9-7-17(8-10-18)4-3-14-29-21(13-15-34-24(29)32)11-12-22(30)25(27,28)19-5-2-6-20(26)16-19/h2,5-12,16,21-22,30H,3-4,13-15H2,1H3 |
| InChIKey | CHXWCZUAMNGTJS-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.39 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|