C25H26N2O3 — CID 7665240
[4-(phenylcarbamoyl)phenyl]methyl 4-(diethylamino)benzoate (PubChem CID 7665240) has the molecular formula C25H26N2O3 and a molecular weight of 402.49 g/mol. Its IUPAC name is [4-(phenylcarbamoyl)phenyl]methyl 4-(diethylamino)benzoate.
| Compound Name | [4-(phenylcarbamoyl)phenyl]methyl 4-(diethylamino)benzoate |
|---|---|
| PubChem CID | 7665240 |
| Molecular Formula | C25H26N2O3 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | [4-(phenylcarbamoyl)phenyl]methyl 4-(diethylamino)benzoate |
| SMILES | CCN(CC)c1ccc(C(=O)OCc2ccc(C(=O)Nc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C25H26N2O3/c1-3-27(4-2)23-16-14-21(15-17-23)25(29)30-18-19-10-12-20(13-11-19)24(28)26-22-8-6-5-7-9-22/h5-17H,3-4,18H2,1-2H3,(H,26,28) |
| InChIKey | MJVOXMYHNAKUJM-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |