C18H20F2N2O — CID 76653421
4-(2,6-difluorophenyl)-1,3,10,10-tetramethyl-3,4-diazatricyclo[5.2.1.02,6]dec-2(6)-en-5-one (PubChem CID 76653421) has the molecular formula C18H20F2N2O and a molecular weight of 318.37 g/mol. Its IUPAC name is 4-(2,6-difluorophenyl)-1,3,10,10-tetramethyl-3,4-diazatricyclo[5.2.1.02,6]dec-2(6)-en-5-one.
| Compound Name | 4-(2,6-difluorophenyl)-1,3,10,10-tetramethyl-3,4-diazatricyclo[5.2.1.02,6]dec-2(6)-en-5-one |
|---|---|
| PubChem CID | 76653421 |
| Molecular Formula | C18H20F2N2O |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 4-(2,6-difluorophenyl)-1,3,10,10-tetramethyl-3,4-diazatricyclo[5.2.1.02,6]dec-2(6)-en-5-one |
| SMILES | Cn1c2c(c(=O)n1-c1c(F)cccc1F)C1CCC2(C)C1(C)C |
| InChI | InChI=1S/C18H20F2N2O/c1-17(2)10-8-9-18(17,3)15-13(10)16(23)22(21(15)4)14-11(19)6-5-7-12(14)20/h5-7,10H,8-9H2,1-4H3 |
| InChIKey | FWDFNGASHIGUFH-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 26.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |