C19H22F2N2O — CID 76653493
4-[(2,4-difluorophenyl)methyl]-1,3,10,10-tetramethyl-3,4-diazatricyclo[5.2.1.02,6]dec-2(6)-en-5-one (PubChem CID 76653493) has the molecular formula C19H22F2N2O and a molecular weight of 332.39 g/mol. Its IUPAC name is 4-[(2,4-difluorophenyl)methyl]-1,3,10,10-tetramethyl-3,4-diazatricyclo[5.2.1.02,6]dec-2(6)-en-5-one.
| Compound Name | 4-[(2,4-difluorophenyl)methyl]-1,3,10,10-tetramethyl-3,4-diazatricyclo[5.2.1.02,6]dec-2(6)-en-5-one |
|---|---|
| PubChem CID | 76653493 |
| Molecular Formula | C19H22F2N2O |
| Molecular Weight | 332.39 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 4-[(2,4-difluorophenyl)methyl]-1,3,10,10-tetramethyl-3,4-diazatricyclo[5.2.1.02,6]dec-2(6)-en-5-one |
| SMILES | Cn1c2c(c(=O)n1Cc1ccc(F)cc1F)C1CCC2(C)C1(C)C |
| InChI | InChI=1S/C19H22F2N2O/c1-18(2)13-7-8-19(18,3)16-15(13)17(24)23(22(16)4)10-11-5-6-12(20)9-14(11)21/h5-6,9,13H,7-8,10H2,1-4H3 |
| InChIKey | CUKCEMUAKKGIGU-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 26.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.39 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |