About 7-amino-1,4-dioxaspiro[4.5]decan-8-ol
7-amino-1,4-dioxaspiro[4.5]decan-8-ol (PubChem CID 76655508) has the molecular formula C8H15NO3
and a molecular weight of 173.21 g/mol. Its IUPAC name is 7-amino-1,4-dioxaspiro[4.5]decan-8-ol.
Molecular Properties
| Compound Name | 7-amino-1,4-dioxaspiro[4.5]decan-8-ol |
| PubChem CID | 76655508 |
| Molecular Formula | C8H15NO3 |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | 7-amino-1,4-dioxaspiro[4.5]decan-8-ol |
| SMILES | NC1CC2(CCC1O)OCCO2 |
| InChI | InChI=1S/C8H15NO3/c9-6-5-8(2-1-7(6)10)11-3-4-12-8/h6-7,10H,1-5,9H2 |
| InChIKey | FGTDXDGJLWGDLI-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-amino-1,4-dioxaspiro[4.5]decan-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-amino-1,4-dioxaspiro[4.5]decan-8-ol?
The IUPAC name of 7-amino-1,4-dioxaspiro[4.5]decan-8-ol (CID 76655508) is 7-amino-1,4-dioxaspiro[4.5]decan-8-ol.
What is the SMILES notation for 7-amino-1,4-dioxaspiro[4.5]decan-8-ol?
The canonical SMILES for 7-amino-1,4-dioxaspiro[4.5]decan-8-ol is NC1CC2(CCC1O)OCCO2.
What is the InChIKey of 7-amino-1,4-dioxaspiro[4.5]decan-8-ol?
The InChIKey is FGTDXDGJLWGDLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO3/c9-6-5-8(2-1-7(6)10)11-3-4-12-8/h6-7,10H,1-5,9H2.
What are the key properties of 7-amino-1,4-dioxaspiro[4.5]decan-8-ol?
7-amino-1,4-dioxaspiro[4.5]decan-8-ol has a molecular weight of 173.21 g/mol, XLogP of -0.40, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-amino-1,4-dioxaspiro[4.5]decan-8-ol is sourced from PubChem (CID 76655508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).