C28H26FN5O5 — CID 76655934
[[1-amino-2-(4-fluorophenyl)ethylidene]amino] 7-morpholin-4-yl-4-oxo-3-phenylmethoxypyrido[1,2-a]pyrimidine-2-carboxylate (PubChem CID 76655934) has the molecular formula C28H26FN5O5 and a molecular weight of 531.54 g/mol. Its IUPAC name is [[1-amino-2-(4-fluorophenyl)ethylidene]amino] 7-morpholin-4-yl-4-oxo-3-phenylmethoxypyrido[1,2-a]pyrimidine-2-carboxylate.
| Compound Name | [[1-amino-2-(4-fluorophenyl)ethylidene]amino] 7-morpholin-4-yl-4-oxo-3-phenylmethoxypyrido[1,2-a]pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 76655934 |
| Molecular Formula | C28H26FN5O5 |
| Molecular Weight | 531.54 g/mol |
| Exact Mass | 531.19 |
| IUPAC Name | [[1-amino-2-(4-fluorophenyl)ethylidene]amino] 7-morpholin-4-yl-4-oxo-3-phenylmethoxypyrido[1,2-a]pyrimidine-2-carboxylate |
| SMILES | NC(Cc1ccc(F)cc1)=NOC(=O)c1nc2ccc(N3CCOCC3)cn2c(=O)c1OCc1ccccc1 |
| InChI | InChI=1S/C28H26FN5O5/c29-21-8-6-19(7-9-21)16-23(30)32-39-28(36)25-26(38-18-20-4-2-1-3-5-20)27(35)34-17-22(10-11-24(34)31-25)33-12-14-37-15-13-33/h1-11,17H,12-16,18H2,(H2,30,32) |
| InChIKey | ANLYAVIVNRMNHS-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.54 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|