About [2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)amino]-2-oxoethyl] 2-(1H-indol-3-yl)acetate
[2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)amino]-2-oxoethyl] 2-(1H-indol-3-yl)acetate (PubChem CID 7665603) has the molecular formula C23H22N4O3
and a molecular weight of 402.45 g/mol. Its IUPAC name is [2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)amino]-2-oxoethyl] 2-(1H-indol-3-yl)acetate.
Molecular Properties
| Compound Name | [2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)amino]-2-oxoethyl] 2-(1H-indol-3-yl)acetate |
| PubChem CID | 7665603 |
| Molecular Formula | C23H22N4O3 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | [2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)amino]-2-oxoethyl] 2-(1H-indol-3-yl)acetate |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1NC(=O)COC(=O)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C23H22N4O3/c1-15-23(16(2)27(26-15)18-8-4-3-5-9-18)25-21(28)14-30-22(29)12-17-13-24-20-11-7-6-10-19(17)20/h3-11,13,24H,12,14H2,1-2H3,(H,25,28) |
| InChIKey | YRMWPBPEAQJBTF-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 89.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)amino]-2-oxoethyl] 2-(1H-indol-3-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)amino]-2-oxoethyl] 2-(1H-indol-3-yl)acetate?
The IUPAC name of [2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)amino]-2-oxoethyl] 2-(1H-indol-3-yl)acetate (CID 7665603) is [2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)amino]-2-oxoethyl] 2-(1H-indol-3-yl)acetate.
What is the SMILES notation for [2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)amino]-2-oxoethyl] 2-(1H-indol-3-yl)acetate?
The canonical SMILES for [2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)amino]-2-oxoethyl] 2-(1H-indol-3-yl)acetate is Cc1nn(-c2ccccc2)c(C)c1NC(=O)COC(=O)Cc1c[nH]c2ccccc12.
What is the InChIKey of [2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)amino]-2-oxoethyl] 2-(1H-indol-3-yl)acetate?
The InChIKey is YRMWPBPEAQJBTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22N4O3/c1-15-23(16(2)27(26-15)18-8-4-3-5-9-18)25-21(28)14-30-22(29)12-17-13-24-20-11-7-6-10-19(17)20/h3-11,13,24H,12,14H2,1-2H3,(H,25,28).
What are the key properties of [2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)amino]-2-oxoethyl] 2-(1H-indol-3-yl)acetate?
[2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)amino]-2-oxoethyl] 2-(1H-indol-3-yl)acetate has a molecular weight of 402.45 g/mol, XLogP of 3.69, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)amino]-2-oxoethyl] 2-(1H-indol-3-yl)acetate is sourced from PubChem (CID 7665603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).