About ethyl 2-amino-5-methyl-1,3-thiazole-4-carboxylate
ethyl 2-amino-5-methyl-1,3-thiazole-4-carboxylate (PubChem CID 766578) has the molecular formula C7H10N2O2S
and a molecular weight of 186.24 g/mol. Its IUPAC name is ethyl 2-amino-5-methyl-1,3-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-amino-5-methyl-1,3-thiazole-4-carboxylate |
| PubChem CID | 766578 |
| Molecular Formula | C7H10N2O2S |
| Molecular Weight | 186.24 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | ethyl 2-amino-5-methyl-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1nc(N)sc1C |
| InChI | InChI=1S/C7H10N2O2S/c1-3-11-6(10)5-4(2)12-7(8)9-5/h3H2,1-2H3,(H2,8,9) |
| InChIKey | KTGUPAFUVGHOQS-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.24 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 2-amino-5-methyl-1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-amino-5-methyl-1,3-thiazole-4-carboxylate?
The IUPAC name of ethyl 2-amino-5-methyl-1,3-thiazole-4-carboxylate (CID 766578) is ethyl 2-amino-5-methyl-1,3-thiazole-4-carboxylate.
What is the SMILES notation for ethyl 2-amino-5-methyl-1,3-thiazole-4-carboxylate?
The canonical SMILES for ethyl 2-amino-5-methyl-1,3-thiazole-4-carboxylate is CCOC(=O)c1nc(N)sc1C.
What is the InChIKey of ethyl 2-amino-5-methyl-1,3-thiazole-4-carboxylate?
The InChIKey is KTGUPAFUVGHOQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O2S/c1-3-11-6(10)5-4(2)12-7(8)9-5/h3H2,1-2H3,(H2,8,9).
What are the key properties of ethyl 2-amino-5-methyl-1,3-thiazole-4-carboxylate?
ethyl 2-amino-5-methyl-1,3-thiazole-4-carboxylate has a molecular weight of 186.24 g/mol, XLogP of 1.21, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-amino-5-methyl-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 766578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).