About 11-tert-butyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one
11-tert-butyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one (PubChem CID 76659535) has the molecular formula C15H26N2O
and a molecular weight of 250.39 g/mol. Its IUPAC name is 11-tert-butyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one.
Molecular Properties
| Compound Name | 11-tert-butyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
| PubChem CID | 76659535 |
| Molecular Formula | C15H26N2O |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.20 |
| IUPAC Name | 11-tert-butyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
| SMILES | CC(C)(C)N1CC2CC(C1)C1CCCC(=O)N1C2 |
| InChI | InChI=1S/C15H26N2O/c1-15(2,3)16-8-11-7-12(10-16)13-5-4-6-14(18)17(13)9-11/h11-13H,4-10H2,1-3H3 |
| InChIKey | KCVQRVIRYRJVQO-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 11-tert-butyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-tert-butyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one?
The IUPAC name of 11-tert-butyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one (CID 76659535) is 11-tert-butyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one.
What is the SMILES notation for 11-tert-butyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one?
The canonical SMILES for 11-tert-butyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one is CC(C)(C)N1CC2CC(C1)C1CCCC(=O)N1C2.
What is the InChIKey of 11-tert-butyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one?
The InChIKey is KCVQRVIRYRJVQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26N2O/c1-15(2,3)16-8-11-7-12(10-16)13-5-4-6-14(18)17(13)9-11/h11-13H,4-10H2,1-3H3.
What are the key properties of 11-tert-butyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one?
11-tert-butyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one has a molecular weight of 250.39 g/mol, XLogP of 2.12, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 11-tert-butyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one is sourced from PubChem (CID 76659535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).