About 4-[2-(1-ethylbenzo[e][1,3]benzothiazol-2-ylidene)ethylidene]-3-phenyl-1,2-oxazol-5-one
4-[2-(1-ethylbenzo[e][1,3]benzothiazol-2-ylidene)ethylidene]-3-phenyl-1,2-oxazol-5-one (PubChem CID 76662127) has the molecular formula C24H18N2O2S
and a molecular weight of 398.49 g/mol. Its IUPAC name is 4-[2-(1-ethylbenzo[e][1,3]benzothiazol-2-ylidene)ethylidene]-3-phenyl-1,2-oxazol-5-one.
Molecular Properties
| Compound Name | 4-[2-(1-ethylbenzo[e][1,3]benzothiazol-2-ylidene)ethylidene]-3-phenyl-1,2-oxazol-5-one |
| PubChem CID | 76662127 |
| Molecular Formula | C24H18N2O2S |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | 4-[2-(1-ethylbenzo[e][1,3]benzothiazol-2-ylidene)ethylidene]-3-phenyl-1,2-oxazol-5-one |
| SMILES | CCN1C(=CC=C2C(=O)ON=C2c2ccccc2)Sc2ccc3ccccc3c21 |
| InChI | InChI=1S/C24H18N2O2S/c1-2-26-21(29-20-14-12-16-8-6-7-11-18(16)23(20)26)15-13-19-22(25-28-24(19)27)17-9-4-3-5-10-17/h3-15H,2H2,1H3 |
| InChIKey | HWOSVQCEUYHHKD-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(1-ethylbenzo[e][1,3]benzothiazol-2-ylidene)ethylidene]-3-phenyl-1,2-oxazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(1-ethylbenzo[e][1,3]benzothiazol-2-ylidene)ethylidene]-3-phenyl-1,2-oxazol-5-one?
The IUPAC name of 4-[2-(1-ethylbenzo[e][1,3]benzothiazol-2-ylidene)ethylidene]-3-phenyl-1,2-oxazol-5-one (CID 76662127) is 4-[2-(1-ethylbenzo[e][1,3]benzothiazol-2-ylidene)ethylidene]-3-phenyl-1,2-oxazol-5-one.
What is the SMILES notation for 4-[2-(1-ethylbenzo[e][1,3]benzothiazol-2-ylidene)ethylidene]-3-phenyl-1,2-oxazol-5-one?
The canonical SMILES for 4-[2-(1-ethylbenzo[e][1,3]benzothiazol-2-ylidene)ethylidene]-3-phenyl-1,2-oxazol-5-one is CCN1C(=CC=C2C(=O)ON=C2c2ccccc2)Sc2ccc3ccccc3c21.
What is the InChIKey of 4-[2-(1-ethylbenzo[e][1,3]benzothiazol-2-ylidene)ethylidene]-3-phenyl-1,2-oxazol-5-one?
The InChIKey is HWOSVQCEUYHHKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H18N2O2S/c1-2-26-21(29-20-14-12-16-8-6-7-11-18(16)23(20)26)15-13-19-22(25-28-24(19)27)17-9-4-3-5-10-17/h3-15H,2H2,1H3.
What are the key properties of 4-[2-(1-ethylbenzo[e][1,3]benzothiazol-2-ylidene)ethylidene]-3-phenyl-1,2-oxazol-5-one?
4-[2-(1-ethylbenzo[e][1,3]benzothiazol-2-ylidene)ethylidene]-3-phenyl-1,2-oxazol-5-one has a molecular weight of 398.49 g/mol, XLogP of 5.50, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(1-ethylbenzo[e][1,3]benzothiazol-2-ylidene)ethylidene]-3-phenyl-1,2-oxazol-5-one is sourced from PubChem (CID 76662127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).