C24H31N3O2 — CID 76662629
[2-(4-tert-butylphenyl)-2-isocyano-1-(2,4,5-trimethylpyrazol-3-yl)ethenyl] 2,2-dimethylpropanoate (PubChem CID 76662629) has the molecular formula C24H31N3O2 and a molecular weight of 393.53 g/mol. Its IUPAC name is [2-(4-tert-butylphenyl)-2-isocyano-1-(2,4,5-trimethylpyrazol-3-yl)ethenyl] 2,2-dimethylpropanoate.
| Compound Name | [2-(4-tert-butylphenyl)-2-isocyano-1-(2,4,5-trimethylpyrazol-3-yl)ethenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 76662629 |
| Molecular Formula | C24H31N3O2 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.24 |
| IUPAC Name | [2-(4-tert-butylphenyl)-2-isocyano-1-(2,4,5-trimethylpyrazol-3-yl)ethenyl] 2,2-dimethylpropanoate |
| SMILES | [C-]#[N+]C(=C(OC(=O)C(C)(C)C)c1c(C)c(C)nn1C)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C24H31N3O2/c1-15-16(2)26-27(10)20(15)21(29-22(28)24(6,7)8)19(25-9)17-11-13-18(14-12-17)23(3,4)5/h11-14H,1-8,10H3 |
| InChIKey | YFIGUOYACHSKLE-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 48.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|