C20H27NO4S2 — CID 76663240
2-[2-[2-(4-hydroxynona-1,5-dienyl)-5-oxocyclopentyl]ethylsulfanyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 76663240) has the molecular formula C20H27NO4S2 and a molecular weight of 409.57 g/mol. Its IUPAC name is 2-[2-[2-(4-hydroxynona-1,5-dienyl)-5-oxocyclopentyl]ethylsulfanyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[2-[2-(4-hydroxynona-1,5-dienyl)-5-oxocyclopentyl]ethylsulfanyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 76663240 |
| Molecular Formula | C20H27NO4S2 |
| Molecular Weight | 409.57 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | 2-[2-[2-(4-hydroxynona-1,5-dienyl)-5-oxocyclopentyl]ethylsulfanyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | CCCC=CC(O)CC=CC1CCC(=O)C1CCSc1nc(C(=O)O)cs1 |
| InChI | InChI=1S/C20H27NO4S2/c1-2-3-4-7-15(22)8-5-6-14-9-10-18(23)16(14)11-12-26-20-21-17(13-27-20)19(24)25/h4-7,13-16,22H,2-3,8-12H2,1H3,(H,24,25) |
| InChIKey | IFLDUQPOSJYPLS-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.57 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|