About [2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] 3-(dimethylamino)benzoate
[2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] 3-(dimethylamino)benzoate (PubChem CID 7667046) has the molecular formula C23H30N2O5
and a molecular weight of 414.50 g/mol. Its IUPAC name is [2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] 3-(dimethylamino)benzoate.
Molecular Properties
| Compound Name | [2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] 3-(dimethylamino)benzoate |
| PubChem CID | 7667046 |
| Molecular Formula | C23H30N2O5 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | [2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] 3-(dimethylamino)benzoate |
| SMILES | CCOc1ccc(CCNC(=O)COC(=O)c2cccc(N(C)C)c2)cc1OCC |
| InChI | InChI=1S/C23H30N2O5/c1-5-28-20-11-10-17(14-21(20)29-6-2)12-13-24-22(26)16-30-23(27)18-8-7-9-19(15-18)25(3)4/h7-11,14-15H,5-6,12-13,16H2,1-4H3,(H,24,26) |
| InChIKey | SMMHMSVMAAQRHY-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] 3-(dimethylamino)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] 3-(dimethylamino)benzoate?
The IUPAC name of [2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] 3-(dimethylamino)benzoate (CID 7667046) is [2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] 3-(dimethylamino)benzoate.
What is the SMILES notation for [2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] 3-(dimethylamino)benzoate?
The canonical SMILES for [2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] 3-(dimethylamino)benzoate is CCOc1ccc(CCNC(=O)COC(=O)c2cccc(N(C)C)c2)cc1OCC.
What is the InChIKey of [2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] 3-(dimethylamino)benzoate?
The InChIKey is SMMHMSVMAAQRHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H30N2O5/c1-5-28-20-11-10-17(14-21(20)29-6-2)12-13-24-22(26)16-30-23(27)18-8-7-9-19(15-18)25(3)4/h7-11,14-15H,5-6,12-13,16H2,1-4H3,(H,24,26).
What are the key properties of [2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] 3-(dimethylamino)benzoate?
[2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] 3-(dimethylamino)benzoate has a molecular weight of 414.50 g/mol, XLogP of 3.07, 11 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] 3-(dimethylamino)benzoate is sourced from PubChem (CID 7667046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).