About tert-butyl N-(3,3-difluoro-2-hydroxycyclohexyl)carbamate
tert-butyl N-(3,3-difluoro-2-hydroxycyclohexyl)carbamate (PubChem CID 76672206) has the molecular formula C11H19F2NO3
and a molecular weight of 251.27 g/mol. Its IUPAC name is tert-butyl N-(3,3-difluoro-2-hydroxycyclohexyl)carbamate.
Molecular Properties
| Compound Name | tert-butyl N-(3,3-difluoro-2-hydroxycyclohexyl)carbamate |
| PubChem CID | 76672206 |
| Molecular Formula | C11H19F2NO3 |
| Molecular Weight | 251.27 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | tert-butyl N-(3,3-difluoro-2-hydroxycyclohexyl)carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCCC(F)(F)C1O |
| InChI | InChI=1S/C11H19F2NO3/c1-10(2,3)17-9(16)14-7-5-4-6-11(12,13)8(7)15/h7-8,15H,4-6H2,1-3H3,(H,14,16) |
| InChIKey | WGGHBJFYNGGDHJ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.27 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl N-(3,3-difluoro-2-hydroxycyclohexyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-(3,3-difluoro-2-hydroxycyclohexyl)carbamate?
The IUPAC name of tert-butyl N-(3,3-difluoro-2-hydroxycyclohexyl)carbamate (CID 76672206) is tert-butyl N-(3,3-difluoro-2-hydroxycyclohexyl)carbamate.
What is the SMILES notation for tert-butyl N-(3,3-difluoro-2-hydroxycyclohexyl)carbamate?
The canonical SMILES for tert-butyl N-(3,3-difluoro-2-hydroxycyclohexyl)carbamate is CC(C)(C)OC(=O)NC1CCCC(F)(F)C1O.
What is the InChIKey of tert-butyl N-(3,3-difluoro-2-hydroxycyclohexyl)carbamate?
The InChIKey is WGGHBJFYNGGDHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19F2NO3/c1-10(2,3)17-9(16)14-7-5-4-6-11(12,13)8(7)15/h7-8,15H,4-6H2,1-3H3,(H,14,16).
What are the key properties of tert-butyl N-(3,3-difluoro-2-hydroxycyclohexyl)carbamate?
tert-butyl N-(3,3-difluoro-2-hydroxycyclohexyl)carbamate has a molecular weight of 251.27 g/mol, XLogP of 2.06, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-(3,3-difluoro-2-hydroxycyclohexyl)carbamate is sourced from PubChem (CID 76672206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).