About N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-4-nitrobenzenesulfonamide
N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-4-nitrobenzenesulfonamide (PubChem CID 7667508) has the molecular formula C14H10ClN5O4S
and a molecular weight of 379.79 g/mol. Its IUPAC name is N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-4-nitrobenzenesulfonamide.
Molecular Properties
| Compound Name | N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-4-nitrobenzenesulfonamide |
| PubChem CID | 7667508 |
| Molecular Formula | C14H10ClN5O4S |
| Molecular Weight | 379.79 g/mol |
| Exact Mass | 379.01 |
| IUPAC Name | N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-4-nitrobenzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)Nc2cc(Cl)ccc2-n2cncn2)cc1 |
| InChI | InChI=1S/C14H10ClN5O4S/c15-10-1-6-14(19-9-16-8-17-19)13(7-10)18-25(23,24)12-4-2-11(3-5-12)20(21)22/h1-9,18H |
| InChIKey | NCCVYSHYNIUELI-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 120.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.79 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-4-nitrobenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-4-nitrobenzenesulfonamide?
The IUPAC name of N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-4-nitrobenzenesulfonamide (CID 7667508) is N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-4-nitrobenzenesulfonamide.
What is the SMILES notation for N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-4-nitrobenzenesulfonamide?
The canonical SMILES for N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-4-nitrobenzenesulfonamide is O=[N+]([O-])c1ccc(S(=O)(=O)Nc2cc(Cl)ccc2-n2cncn2)cc1.
What is the InChIKey of N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-4-nitrobenzenesulfonamide?
The InChIKey is NCCVYSHYNIUELI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10ClN5O4S/c15-10-1-6-14(19-9-16-8-17-19)13(7-10)18-25(23,24)12-4-2-11(3-5-12)20(21)22/h1-9,18H.
What are the key properties of N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-4-nitrobenzenesulfonamide?
N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-4-nitrobenzenesulfonamide has a molecular weight of 379.79 g/mol, XLogP of 2.63, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-4-nitrobenzenesulfonamide is sourced from PubChem (CID 7667508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).