C47H48ClF3N6O2 — CID 76675907
propan-2-yl 4-[[3-chloro-5-(trifluoromethyl)phenyl]methyl-[5-(1-tritylimidazol-4-yl)pyrimidin-2-yl]amino]-2,6-diethylpiperidine-1-carboxylate (PubChem CID 76675907) has the molecular formula C47H48ClF3N6O2 and a molecular weight of 821.39 g/mol. Its IUPAC name is propan-2-yl 4-[[3-chloro-5-(trifluoromethyl)phenyl]methyl-[5-(1-tritylimidazol-4-yl)pyrimidin-2-yl]amino]-2,6-diethylpiperidine-1-carboxylate.
| Compound Name | propan-2-yl 4-[[3-chloro-5-(trifluoromethyl)phenyl]methyl-[5-(1-tritylimidazol-4-yl)pyrimidin-2-yl]amino]-2,6-diethylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 76675907 |
| Molecular Formula | C47H48ClF3N6O2 |
| Molecular Weight | 821.39 g/mol |
| Exact Mass | 820.35 |
| IUPAC Name | propan-2-yl 4-[[3-chloro-5-(trifluoromethyl)phenyl]methyl-[5-(1-tritylimidazol-4-yl)pyrimidin-2-yl]amino]-2,6-diethylpiperidine-1-carboxylate |
| SMILES | CCC1CC(N(Cc2cc(Cl)cc(C(F)(F)F)c2)c2ncc(-c3cn(C(c4ccccc4)(c4ccccc4)c4ccccc4)cn3)cn2)CC(CC)N1C(=O)OC(C)C |
| InChI | InChI=1S/C47H48ClF3N6O2/c1-5-40-25-42(26-41(6-2)57(40)45(58)59-32(3)4)56(29-33-22-38(47(49,50)51)24-39(48)23-33)44-52-27-34(28-53-44)43-30-55(31-54-43)46(35-16-10-7-11-17-35,36-18-12-8-13-19-36)37-20-14-9-15-21-37/h7-24,27-28,30-32,40-42H,5-6,25-26,29H2,1-4H3 |
| InChIKey | HDEGHPNRUGIIJK-UHFFFAOYSA-N |
| XLogP | 11.43 |
| TPSA | 76.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.39 |
| LogP ≤ 5 | 11.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|