C13H16Cl2N6 — CID 766777
6-N-(3,4-dichlorophenyl)-2-N,2-N,4-N,4-N-tetramethyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 766777) has the molecular formula C13H16Cl2N6 and a molecular weight of 327.22 g/mol. Its IUPAC name is 6-N-(3,4-dichlorophenyl)-2-N,2-N,4-N,4-N-tetramethyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 6-N-(3,4-dichlorophenyl)-2-N,2-N,4-N,4-N-tetramethyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 766777 |
| Molecular Formula | C13H16Cl2N6 |
| Molecular Weight | 327.22 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | 6-N-(3,4-dichlorophenyl)-2-N,2-N,4-N,4-N-tetramethyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CN(C)c1nc(Nc2ccc(Cl)c(Cl)c2)nc(N(C)C)n1 |
| InChI | InChI=1S/C13H16Cl2N6/c1-20(2)12-17-11(18-13(19-12)21(3)4)16-8-5-6-9(14)10(15)7-8/h5-7H,1-4H3,(H,16,17,18,19) |
| InChIKey | AMBGYJYZJKGTBS-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.22 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |