C20H34N4O3 — CID 76680406
N-[3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-3-(3-hydroxy-3-methylbutyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1-carboxamide (PubChem CID 76680406) has the molecular formula C20H34N4O3 and a molecular weight of 378.52 g/mol. Its IUPAC name is N-[3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-3-(3-hydroxy-3-methylbutyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1-carboxamide.
| Compound Name | N-[3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-3-(3-hydroxy-3-methylbutyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1-carboxamide |
|---|---|
| PubChem CID | 76680406 |
| Molecular Formula | C20H34N4O3 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.26 |
| IUPAC Name | N-[3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-3-(3-hydroxy-3-methylbutyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1-carboxamide |
| SMILES | CNC(=O)C(NC(=O)c1nc(CCC(C)(C)O)n2c1CCCC2)C(C)(C)C |
| InChI | InChI=1S/C20H34N4O3/c1-19(2,3)16(18(26)21-6)23-17(25)15-13-9-7-8-12-24(13)14(22-15)10-11-20(4,5)27/h16,27H,7-12H2,1-6H3,(H,21,26)(H,23,25) |
| InChIKey | MCFRRBBBEMOURK-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |