C25H33N3O2 — CID 76682548
5-butoxy-N-methyl-N-[5-(pyrrolidin-1-ylmethyl)-2,3-dihydro-1H-inden-2-yl]pyridine-2-carboxamide (PubChem CID 76682548) has the molecular formula C25H33N3O2 and a molecular weight of 407.56 g/mol. Its IUPAC name is 5-butoxy-N-methyl-N-[5-(pyrrolidin-1-ylmethyl)-2,3-dihydro-1H-inden-2-yl]pyridine-2-carboxamide.
| Compound Name | 5-butoxy-N-methyl-N-[5-(pyrrolidin-1-ylmethyl)-2,3-dihydro-1H-inden-2-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 76682548 |
| Molecular Formula | C25H33N3O2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | 5-butoxy-N-methyl-N-[5-(pyrrolidin-1-ylmethyl)-2,3-dihydro-1H-inden-2-yl]pyridine-2-carboxamide |
| SMILES | CCCCOc1ccc(C(=O)N(C)C2Cc3ccc(CN4CCCC4)cc3C2)nc1 |
| InChI | InChI=1S/C25H33N3O2/c1-3-4-13-30-23-9-10-24(26-17-23)25(29)27(2)22-15-20-8-7-19(14-21(20)16-22)18-28-11-5-6-12-28/h7-10,14,17,22H,3-6,11-13,15-16,18H2,1-2H3 |
| InChIKey | HCFQNVLQUQVSFT-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|