C31H34N6O2 — CID 76683078
1-cyclopropyl-N-methoxy-1-[6-[2-[4-(2-methylquinolin-5-yl)piperazin-1-yl]ethyl]-4H-imidazo[5,1-c][1,4]benzoxazin-3-yl]methanimine (PubChem CID 76683078) has the molecular formula C31H34N6O2 and a molecular weight of 522.65 g/mol. Its IUPAC name is 1-cyclopropyl-N-methoxy-1-[6-[2-[4-(2-methylquinolin-5-yl)piperazin-1-yl]ethyl]-4H-imidazo[5,1-c][1,4]benzoxazin-3-yl]methanimine.
| Compound Name | 1-cyclopropyl-N-methoxy-1-[6-[2-[4-(2-methylquinolin-5-yl)piperazin-1-yl]ethyl]-4H-imidazo[5,1-c][1,4]benzoxazin-3-yl]methanimine |
|---|---|
| PubChem CID | 76683078 |
| Molecular Formula | C31H34N6O2 |
| Molecular Weight | 522.65 g/mol |
| Exact Mass | 522.27 |
| IUPAC Name | 1-cyclopropyl-N-methoxy-1-[6-[2-[4-(2-methylquinolin-5-yl)piperazin-1-yl]ethyl]-4H-imidazo[5,1-c][1,4]benzoxazin-3-yl]methanimine |
| SMILES | CON=C(c1ncn2c1COc1c(CCN3CCN(c4cccc5nc(C)ccc45)CC3)cccc1-2)C1CC1 |
| InChI | InChI=1S/C31H34N6O2/c1-21-9-12-24-25(33-21)6-4-7-26(24)36-17-15-35(16-18-36)14-13-23-5-3-8-27-31(23)39-19-28-30(32-20-37(27)28)29(34-38-2)22-10-11-22/h3-9,12,20,22H,10-11,13-19H2,1-2H3 |
| InChIKey | XHMZJSJGCUAJIL-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 68.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.65 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|