C23H25F3O10 — CID 76683524
(2R,3S,4R,5S,6R)-2-(hydroxymethyl)-6-[2-[3-(trifluoromethyl)-4-[2-[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]phenyl]ethynyl]oxane-3,4,5-triol (PubChem CID 76683524) has the molecular formula C23H25F3O10 and a molecular weight of 518.44 g/mol. Its IUPAC name is (2R,3S,4R,5S,6R)-2-(hydroxymethyl)-6-[2-[3-(trifluoromethyl)-4-[2-[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]phenyl]ethynyl]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4R,5S,6R)-2-(hydroxymethyl)-6-[2-[3-(trifluoromethyl)-4-[2-[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]phenyl]ethynyl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 76683524 |
| Molecular Formula | C23H25F3O10 |
| Molecular Weight | 518.44 g/mol |
| Exact Mass | 518.14 |
| IUPAC Name | (2R,3S,4R,5S,6R)-2-(hydroxymethyl)-6-[2-[3-(trifluoromethyl)-4-[2-[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]phenyl]ethynyl]oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@H](C#Cc2ccc(C#C[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)c(C(F)(F)F)c2)[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H25F3O10/c24-23(25,26)12-7-10(2-5-13-17(29)21(33)19(31)15(8-27)35-13)1-3-11(12)4-6-14-18(30)22(34)20(32)16(9-28)36-14/h1,3,7,13-22,27-34H,8-9H2/t13-,14-,15-,16-,17-,18-,19-,20-,21-,22-/m1/s1 |
| InChIKey | CEEMBZFFTDWBEG-HWQNPIRBSA-N |
| XLogP | -2.91 |
| TPSA | 180.30 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.44 |
| LogP ≤ 5 | -2.91 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|