About tert-butyl 2-[(6-methyl-5,8-dioxonaphthalene-2-carbonyl)amino]acetate
tert-butyl 2-[(6-methyl-5,8-dioxonaphthalene-2-carbonyl)amino]acetate (PubChem CID 76683547) has the molecular formula C18H19NO5
and a molecular weight of 329.35 g/mol. Its IUPAC name is tert-butyl 2-[(6-methyl-5,8-dioxonaphthalene-2-carbonyl)amino]acetate.
Molecular Properties
| Compound Name | tert-butyl 2-[(6-methyl-5,8-dioxonaphthalene-2-carbonyl)amino]acetate |
| PubChem CID | 76683547 |
| Molecular Formula | C18H19NO5 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | tert-butyl 2-[(6-methyl-5,8-dioxonaphthalene-2-carbonyl)amino]acetate |
| SMILES | CC1=CC(=O)c2cc(C(=O)NCC(=O)OC(C)(C)C)ccc2C1=O |
| InChI | InChI=1S/C18H19NO5/c1-10-7-14(20)13-8-11(5-6-12(13)16(10)22)17(23)19-9-15(21)24-18(2,3)4/h5-8H,9H2,1-4H3,(H,19,23) |
| InChIKey | ADXNDYAOIAKULA-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-[(6-methyl-5,8-dioxonaphthalene-2-carbonyl)amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-[(6-methyl-5,8-dioxonaphthalene-2-carbonyl)amino]acetate?
The IUPAC name of tert-butyl 2-[(6-methyl-5,8-dioxonaphthalene-2-carbonyl)amino]acetate (CID 76683547) is tert-butyl 2-[(6-methyl-5,8-dioxonaphthalene-2-carbonyl)amino]acetate.
What is the SMILES notation for tert-butyl 2-[(6-methyl-5,8-dioxonaphthalene-2-carbonyl)amino]acetate?
The canonical SMILES for tert-butyl 2-[(6-methyl-5,8-dioxonaphthalene-2-carbonyl)amino]acetate is CC1=CC(=O)c2cc(C(=O)NCC(=O)OC(C)(C)C)ccc2C1=O.
What is the InChIKey of tert-butyl 2-[(6-methyl-5,8-dioxonaphthalene-2-carbonyl)amino]acetate?
The InChIKey is ADXNDYAOIAKULA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NO5/c1-10-7-14(20)13-8-11(5-6-12(13)16(10)22)17(23)19-9-15(21)24-18(2,3)4/h5-8H,9H2,1-4H3,(H,19,23).
What are the key properties of tert-butyl 2-[(6-methyl-5,8-dioxonaphthalene-2-carbonyl)amino]acetate?
tert-butyl 2-[(6-methyl-5,8-dioxonaphthalene-2-carbonyl)amino]acetate has a molecular weight of 329.35 g/mol, XLogP of 2.08, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-[(6-methyl-5,8-dioxonaphthalene-2-carbonyl)amino]acetate is sourced from PubChem (CID 76683547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).