About 1-(2,4-dichlorophenyl)-N-(2-piperidin-1-ylethyl)triazol-4-amine
1-(2,4-dichlorophenyl)-N-(2-piperidin-1-ylethyl)triazol-4-amine (PubChem CID 76683680) has the molecular formula C15H19Cl2N5
and a molecular weight of 340.26 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-N-(2-piperidin-1-ylethyl)triazol-4-amine.
Molecular Properties
| Compound Name | 1-(2,4-dichlorophenyl)-N-(2-piperidin-1-ylethyl)triazol-4-amine |
| PubChem CID | 76683680 |
| Molecular Formula | C15H19Cl2N5 |
| Molecular Weight | 340.26 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-N-(2-piperidin-1-ylethyl)triazol-4-amine |
| SMILES | Clc1ccc(-n2cc(NCCN3CCCCC3)nn2)c(Cl)c1 |
| InChI | InChI=1S/C15H19Cl2N5/c16-12-4-5-14(13(17)10-12)22-11-15(19-20-22)18-6-9-21-7-2-1-3-8-21/h4-5,10-11,18H,1-3,6-9H2 |
| InChIKey | LZDOBGCHNLXCAW-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.26 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(2,4-dichlorophenyl)-N-(2-piperidin-1-ylethyl)triazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,4-dichlorophenyl)-N-(2-piperidin-1-ylethyl)triazol-4-amine?
The IUPAC name of 1-(2,4-dichlorophenyl)-N-(2-piperidin-1-ylethyl)triazol-4-amine (CID 76683680) is 1-(2,4-dichlorophenyl)-N-(2-piperidin-1-ylethyl)triazol-4-amine.
What is the SMILES notation for 1-(2,4-dichlorophenyl)-N-(2-piperidin-1-ylethyl)triazol-4-amine?
The canonical SMILES for 1-(2,4-dichlorophenyl)-N-(2-piperidin-1-ylethyl)triazol-4-amine is Clc1ccc(-n2cc(NCCN3CCCCC3)nn2)c(Cl)c1.
What is the InChIKey of 1-(2,4-dichlorophenyl)-N-(2-piperidin-1-ylethyl)triazol-4-amine?
The InChIKey is LZDOBGCHNLXCAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19Cl2N5/c16-12-4-5-14(13(17)10-12)22-11-15(19-20-22)18-6-9-21-7-2-1-3-8-21/h4-5,10-11,18H,1-3,6-9H2.
What are the key properties of 1-(2,4-dichlorophenyl)-N-(2-piperidin-1-ylethyl)triazol-4-amine?
1-(2,4-dichlorophenyl)-N-(2-piperidin-1-ylethyl)triazol-4-amine has a molecular weight of 340.26 g/mol, XLogP of 3.47, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,4-dichlorophenyl)-N-(2-piperidin-1-ylethyl)triazol-4-amine is sourced from PubChem (CID 76683680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).