C29H35N3Si — CID 76683684
[4-[4-(4-tert-butylphenyl)-5-(2,6-dimethylphenyl)-1,2,4-triazol-3-yl]phenyl]-trimethylsilane (PubChem CID 76683684) has the molecular formula C29H35N3Si and a molecular weight of 453.71 g/mol. Its IUPAC name is [4-[4-(4-tert-butylphenyl)-5-(2,6-dimethylphenyl)-1,2,4-triazol-3-yl]phenyl]-trimethylsilane.
| Compound Name | [4-[4-(4-tert-butylphenyl)-5-(2,6-dimethylphenyl)-1,2,4-triazol-3-yl]phenyl]-trimethylsilane |
|---|---|
| PubChem CID | 76683684 |
| Molecular Formula | C29H35N3Si |
| Molecular Weight | 453.71 g/mol |
| Exact Mass | 453.26 |
| IUPAC Name | [4-[4-(4-tert-butylphenyl)-5-(2,6-dimethylphenyl)-1,2,4-triazol-3-yl]phenyl]-trimethylsilane |
| SMILES | Cc1cccc(C)c1-c1nnc(-c2ccc([Si](C)(C)C)cc2)n1-c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C29H35N3Si/c1-20-10-9-11-21(2)26(20)28-31-30-27(22-12-18-25(19-13-22)33(6,7)8)32(28)24-16-14-23(15-17-24)29(3,4)5/h9-19H,1-8H3 |
| InChIKey | SBJBSQMJEZDZFU-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.71 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|