C18H21F3N2O3S — CID 76683752
(3aR,5R,6S,7R,7aR)-2-(dimethylamino)-5-[(Z)-1,1,1-trifluoro-4-phenylbut-2-en-2-yl]-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-6,7-diol (PubChem CID 76683752) has the molecular formula C18H21F3N2O3S and a molecular weight of 402.44 g/mol. Its IUPAC name is (3aR,5R,6S,7R,7aR)-2-(dimethylamino)-5-[(Z)-1,1,1-trifluoro-4-phenylbut-2-en-2-yl]-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-6,7-diol.
| Compound Name | (3aR,5R,6S,7R,7aR)-2-(dimethylamino)-5-[(Z)-1,1,1-trifluoro-4-phenylbut-2-en-2-yl]-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-6,7-diol |
|---|---|
| PubChem CID | 76683752 |
| Molecular Formula | C18H21F3N2O3S |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | (3aR,5R,6S,7R,7aR)-2-(dimethylamino)-5-[(Z)-1,1,1-trifluoro-4-phenylbut-2-en-2-yl]-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-6,7-diol |
| SMILES | CN(C)C1=N[C@@H]2[C@@H](O)[C@H](O)[C@@H](/C(=C/Cc3ccccc3)C(F)(F)F)O[C@@H]2S1 |
| InChI | InChI=1S/C18H21F3N2O3S/c1-23(2)17-22-12-13(24)14(25)15(26-16(12)27-17)11(18(19,20)21)9-8-10-6-4-3-5-7-10/h3-7,9,12-16,24-25H,8H2,1-2H3/b11-9-/t12-,13-,14+,15-,16-/m1/s1 |
| InChIKey | VMFWQJMGEJBVPI-WYOABKTPSA-N |
| XLogP | 2.20 |
| TPSA | 65.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|