C10H10O3 — CID 76684149
5-hydroxy-2,3,4a,8a-tetrahydronaphthalene-1,4-dione (PubChem CID 76684149) has the molecular formula C10H10O3 and a molecular weight of 178.19 g/mol. Its IUPAC name is 5-hydroxy-2,3,4a,8a-tetrahydronaphthalene-1,4-dione.
| Compound Name | 5-hydroxy-2,3,4a,8a-tetrahydronaphthalene-1,4-dione |
|---|---|
| PubChem CID | 76684149 |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | 5-hydroxy-2,3,4a,8a-tetrahydronaphthalene-1,4-dione |
| SMILES | O=C1CCC(=O)C2C(O)=CC=CC12 |
| InChI | InChI=1S/C10H10O3/c11-7-4-5-9(13)10-6(7)2-1-3-8(10)12/h1-3,6,10,12H,4-5H2 |
| InChIKey | BTIDOVJLITVZNY-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |