C28H31F2N7O3 — CID 76684168
(3R,4R,5S)-3-amino-1-[3-[[2-[2,6-difluoro-4-(oxan-4-yloxy)phenyl]imidazo[1,5-b]pyridazin-7-yl]amino]-4-pyridinyl]-5-methylpiperidin-4-ol (PubChem CID 76684168) has the molecular formula C28H31F2N7O3 and a molecular weight of 551.60 g/mol. Its IUPAC name is (3R,4R,5S)-3-amino-1-[3-[[2-[2,6-difluoro-4-(oxan-4-yloxy)phenyl]imidazo[1,5-b]pyridazin-7-yl]amino]-4-pyridinyl]-5-methylpiperidin-4-ol.
| Compound Name | (3R,4R,5S)-3-amino-1-[3-[[2-[2,6-difluoro-4-(oxan-4-yloxy)phenyl]imidazo[1,5-b]pyridazin-7-yl]amino]-4-pyridinyl]-5-methylpiperidin-4-ol |
|---|---|
| PubChem CID | 76684168 |
| Molecular Formula | C28H31F2N7O3 |
| Molecular Weight | 551.60 g/mol |
| Exact Mass | 551.25 |
| IUPAC Name | (3R,4R,5S)-3-amino-1-[3-[[2-[2,6-difluoro-4-(oxan-4-yloxy)phenyl]imidazo[1,5-b]pyridazin-7-yl]amino]-4-pyridinyl]-5-methylpiperidin-4-ol |
| SMILES | C[C@H]1CN(c2ccncc2Nc2ncc3ccc(-c4c(F)cc(OC5CCOCC5)cc4F)nn23)C[C@@H](N)[C@@H]1O |
| InChI | InChI=1S/C28H31F2N7O3/c1-16-14-36(15-22(31)27(16)38)25-4-7-32-13-24(25)34-28-33-12-17-2-3-23(35-37(17)28)26-20(29)10-19(11-21(26)30)40-18-5-8-39-9-6-18/h2-4,7,10-13,16,18,22,27,38H,5-6,8-9,14-15,31H2,1H3,(H,33,34)/t16-,22+,27+/m0/s1 |
| InChIKey | NOZJGJSOAUPZKT-DRWOTAJISA-N |
| XLogP | 3.52 |
| TPSA | 123.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.60 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |