C25H25ClN2O5 — CID 76684488
9-[2-(2-chlorophenoxy)ethoxy]-2-(oxolan-2-ylmethoxy)-6,7-dihydropyrimido[6,1-a]isoquinolin-4-one (PubChem CID 76684488) has the molecular formula C25H25ClN2O5 and a molecular weight of 468.94 g/mol. Its IUPAC name is 9-[2-(2-chlorophenoxy)ethoxy]-2-(oxolan-2-ylmethoxy)-6,7-dihydropyrimido[6,1-a]isoquinolin-4-one.
| Compound Name | 9-[2-(2-chlorophenoxy)ethoxy]-2-(oxolan-2-ylmethoxy)-6,7-dihydropyrimido[6,1-a]isoquinolin-4-one |
|---|---|
| PubChem CID | 76684488 |
| Molecular Formula | C25H25ClN2O5 |
| Molecular Weight | 468.94 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | 9-[2-(2-chlorophenoxy)ethoxy]-2-(oxolan-2-ylmethoxy)-6,7-dihydropyrimido[6,1-a]isoquinolin-4-one |
| SMILES | O=c1nc(OCC2CCCO2)cc2n1CCc1cc(OCCOc3ccccc3Cl)ccc1-2 |
| InChI | InChI=1S/C25H25ClN2O5/c26-21-5-1-2-6-23(21)32-13-12-31-18-7-8-20-17(14-18)9-10-28-22(20)15-24(27-25(28)29)33-16-19-4-3-11-30-19/h1-2,5-8,14-15,19H,3-4,9-13,16H2 |
| InChIKey | VAVUTMLKXBXMPY-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 71.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.94 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|