C20H24ClFN4O — CID 76684792
2-[3-(4-chloro-3-fluorophenoxy)propyl]-5,7-di(propan-2-yl)-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 76684792) has the molecular formula C20H24ClFN4O and a molecular weight of 390.89 g/mol. Its IUPAC name is 2-[3-(4-chloro-3-fluorophenoxy)propyl]-5,7-di(propan-2-yl)-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | 2-[3-(4-chloro-3-fluorophenoxy)propyl]-5,7-di(propan-2-yl)-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 76684792 |
| Molecular Formula | C20H24ClFN4O |
| Molecular Weight | 390.89 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 2-[3-(4-chloro-3-fluorophenoxy)propyl]-5,7-di(propan-2-yl)-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | CC(C)c1cc(C(C)C)n2nc(CCCOc3ccc(Cl)c(F)c3)nc2n1 |
| InChI | InChI=1S/C20H24ClFN4O/c1-12(2)17-11-18(13(3)4)26-20(23-17)24-19(25-26)6-5-9-27-14-7-8-15(21)16(22)10-14/h7-8,10-13H,5-6,9H2,1-4H3 |
| InChIKey | MRVFGUFEKKTPSV-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 52.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.89 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|