C16H14ClF3N4O — CID 76684923
2-[3-(4-chlorophenoxy)propyl]-5-methyl-7-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 76684923) has the molecular formula C16H14ClF3N4O and a molecular weight of 370.76 g/mol. Its IUPAC name is 2-[3-(4-chlorophenoxy)propyl]-5-methyl-7-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | 2-[3-(4-chlorophenoxy)propyl]-5-methyl-7-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 76684923 |
| Molecular Formula | C16H14ClF3N4O |
| Molecular Weight | 370.76 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | 2-[3-(4-chlorophenoxy)propyl]-5-methyl-7-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | Cc1cc(C(F)(F)F)n2nc(CCCOc3ccc(Cl)cc3)nc2n1 |
| InChI | InChI=1S/C16H14ClF3N4O/c1-10-9-13(16(18,19)20)24-15(21-10)22-14(23-24)3-2-8-25-12-6-4-11(17)5-7-12/h4-7,9H,2-3,8H2,1H3 |
| InChIKey | GOHCSGRRSUFFAG-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 52.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.76 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|