C22H33N3O5Pt — CID 76685184
1-[(3-methoxyphenyl)methyl]azetidine-3,3-dicarboxylate;platinum(2+);trans-(1R,2R)-2-N-propan-2-ylcyclohexane-1,2-diamine (PubChem CID 76685184) has the molecular formula C22H33N3O5Pt and a molecular weight of 614.60 g/mol. Its IUPAC name is 1-[(3-methoxyphenyl)methyl]azetidine-3,3-dicarboxylate;platinum(2+);trans-(1R,2R)-2-N-propan-2-ylcyclohexane-1,2-diamine.
| Compound Name | 1-[(3-methoxyphenyl)methyl]azetidine-3,3-dicarboxylate;platinum(2+);trans-(1R,2R)-2-N-propan-2-ylcyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 76685184 |
| Molecular Formula | C22H33N3O5Pt |
| Molecular Weight | 614.60 g/mol |
| Exact Mass | 614.21 |
| IUPAC Name | 1-[(3-methoxyphenyl)methyl]azetidine-3,3-dicarboxylate;platinum(2+);trans-(1R,2R)-2-N-propan-2-ylcyclohexane-1,2-diamine |
| SMILES | CC(C)N[C@@H]1CCCC[C@H]1N.COc1cccc(CN2CC(C(=O)[O-])(C(=O)[O-])C2)c1.[Pt+2] |
| InChI | InChI=1S/C13H15NO5.C9H20N2.Pt/c1-19-10-4-2-3-9(5-10)6-14-7-13(8-14,11(15)16)12(17)18;1-7(2)11-9-6-4-3-5-8(9)10;/h2-5H,6-8H2,1H3,(H,15,16)(H,17,18);7-9,11H,3-6,10H2,1-2H3;/q;;+2/p-2/t;8-,9-;/m.1./s1 |
| InChIKey | BNFONTLGYIDEGR-IJKLMLNUSA-L |
| XLogP | -0.75 |
| TPSA | 130.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.60 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|