C19H35N4O3S2+ — CID 76685238
[(2S,5R,6R)-6-(tert-butylcarbamothioylamino)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carbonyl]oxy-triethylazanium (PubChem CID 76685238) has the molecular formula C19H35N4O3S2+ and a molecular weight of 431.65 g/mol. Its IUPAC name is [(2S,5R,6R)-6-(tert-butylcarbamothioylamino)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carbonyl]oxy-triethylazanium.
| Compound Name | [(2S,5R,6R)-6-(tert-butylcarbamothioylamino)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carbonyl]oxy-triethylazanium |
|---|---|
| PubChem CID | 76685238 |
| Molecular Formula | C19H35N4O3S2+ |
| Molecular Weight | 431.65 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | [(2S,5R,6R)-6-(tert-butylcarbamothioylamino)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carbonyl]oxy-triethylazanium |
| SMILES | CC[N+](CC)(CC)OC(=O)[C@@H]1N2C(=O)[C@@H](NC(=S)NC(C)(C)C)[C@H]2SC1(C)C |
| InChI | InChI=1S/C19H34N4O3S2/c1-9-23(10-2,11-3)26-16(25)13-19(7,8)28-15-12(14(24)22(13)15)20-17(27)21-18(4,5)6/h12-13,15H,9-11H2,1-8H3,(H-,20,21,27)/p+1/t12-,13+,15-/m1/s1 |
| InChIKey | DEERWUAZHDCHRQ-VNHYZAJKSA-O |
| XLogP | 2.01 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.65 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|