C40H71NO6 — CID 76686515
(2,4-dioxo-1,5-dioxacyclohexatriaconta-11,30-dien-21-yl) 4-(dimethylamino)butanoate (PubChem CID 76686515) has the molecular formula C40H71NO6 and a molecular weight of 662.01 g/mol. Its IUPAC name is (2,4-dioxo-1,5-dioxacyclohexatriaconta-11,30-dien-21-yl) 4-(dimethylamino)butanoate.
| Compound Name | (2,4-dioxo-1,5-dioxacyclohexatriaconta-11,30-dien-21-yl) 4-(dimethylamino)butanoate |
|---|---|
| PubChem CID | 76686515 |
| Molecular Formula | C40H71NO6 |
| Molecular Weight | 662.01 g/mol |
| Exact Mass | 661.53 |
| IUPAC Name | (2,4-dioxo-1,5-dioxacyclohexatriaconta-11,30-dien-21-yl) 4-(dimethylamino)butanoate |
| SMILES | CN(C)CCCC(=O)OC1CCCCCCCCC=CCCCCCOC(=O)CC(=O)OCCCCCC=CCCCCCCCC1 |
| InChI | InChI=1S/C40H71NO6/c1-41(2)33-29-32-38(42)47-37-30-25-21-17-13-9-5-3-7-11-15-19-23-27-34-45-39(43)36-40(44)46-35-28-24-20-16-12-8-4-6-10-14-18-22-26-31-37/h7-8,11-12,37H,3-6,9-10,13-36H2,1-2H3 |
| InChIKey | ORXGGSASKKUTLF-UHFFFAOYSA-N |
| XLogP | 10.20 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.01 |
| LogP ≤ 5 | 10.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|