C27H27FN6O — CID 76687271
3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl-[4-[5-[2-(6-amino-3-pyridinyl)ethynyl]-6-ethylpyrimidin-4-yl]-2-fluorophenyl]methanone (PubChem CID 76687271) has the molecular formula C27H27FN6O and a molecular weight of 470.55 g/mol. Its IUPAC name is 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl-[4-[5-[2-(6-amino-3-pyridinyl)ethynyl]-6-ethylpyrimidin-4-yl]-2-fluorophenyl]methanone.
| Compound Name | 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl-[4-[5-[2-(6-amino-3-pyridinyl)ethynyl]-6-ethylpyrimidin-4-yl]-2-fluorophenyl]methanone |
|---|---|
| PubChem CID | 76687271 |
| Molecular Formula | C27H27FN6O |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl-[4-[5-[2-(6-amino-3-pyridinyl)ethynyl]-6-ethylpyrimidin-4-yl]-2-fluorophenyl]methanone |
| SMILES | CCc1ncnc(-c2ccc(C(=O)N3CCN4CCCC4C3)c(F)c2)c1C#Cc1ccc(N)nc1 |
| InChI | InChI=1S/C27H27FN6O/c1-2-24-22(8-5-18-6-10-25(29)30-15-18)26(32-17-31-24)19-7-9-21(23(28)14-19)27(35)34-13-12-33-11-3-4-20(33)16-34/h6-7,9-10,14-15,17,20H,2-4,11-13,16H2,1H3,(H2,29,30) |
| InChIKey | VIZDWFMDXKHPJD-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|